CAS 1220037-18-2

Piperidine, 3-(2-bromophenoxy)-, hydrochloride (1:1)

Description:

Piperidine, 3-(2-bromophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a 2-bromophenoxy substituent, indicating the presence of a bromine atom on a phenyl ring that is ether-linked to the piperidine. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water and other polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structure suggests potential interactions with various biological targets, and it may be used in the synthesis of other chemical entities. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health risks. Overall, Piperidine, 3-(2-bromophenoxy)-, hydrochloride is a notable compound in the realm of organic chemistry, particularly for its potential applications in drug development and research.

Formula: C₁₁H₁₄BrNO·ClH

InChI: InChI=1S/C11H14BrNO.ClH/c12-10-5-1-2-6-11(10)14-9-4-3-7-13-8-9;/h1-2,5-6,9,13H,3-4,7-8H2;1H

InChI key: InChIKey=UVZLWVAOELPHFV-UHFFFAOYSA-N

SMILES: O(C1=C(Br)C=CC=C1)C2CCCNC2.Cl

Synonyms:

• Piperidine, 3-(2-bromophenoxy)-, hydrochloride (1:1)