CAS 1220037-32-0

2-Furancarboxamide, N-4-piperidinyl-, hydrochloride (1:1)

Description:

2-Furancarboxamide, N-4-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a furan ring and a piperidine moiety. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form. It is often studied for its potential pharmacological properties, particularly in the context of medicinal chemistry, where it may exhibit biological activity relevant to various therapeutic areas. The presence of the piperidine group can influence its interaction with biological targets, potentially affecting its efficacy and safety profile. As with many compounds, handling should be done with care, considering appropriate safety protocols, as it may have specific toxicity or reactivity profiles. Its synthesis and characterization are important for understanding its properties and potential applications in drug development or other chemical processes.

Formula: C₁₀H₁₄N₂O₂·ClH

InChI: InChI=1S/C10H14N2O2.ClH/c13-10(9-2-1-7-14-9)12-8-3-5-11-6-4-8;/h1-2,7-8,11H,3-6H2,(H,12,13);1H

InChI key: InChIKey=YOYOLKAXTYRSBX-UHFFFAOYSA-N

SMILES: C(NC1CCNCC1)(=O)C2=CC=CO2.Cl

Synonyms:

• 2-Furancarboxamide, N-4-piperidinyl-, hydrochloride (1:1)