CymitQuimica logo

CAS 1220037-33-1

:

1-[2-Amino-4-(trifluoromethyl)phenyl]-3-pyrrolidinol

Description:
1-[2-Amino-4-(trifluoromethyl)phenyl]-3-pyrrolidinol is an organic compound characterized by its unique molecular structure, which includes a pyrrolidine ring and a trifluoromethyl-substituted phenyl group. This compound features an amino group that enhances its potential for hydrogen bonding and reactivity. The presence of the trifluoromethyl group significantly influences its electronic properties, making it more lipophilic and potentially altering its biological activity. The pyrrolidinol moiety contributes to its stability and solubility in various solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific interactions and applications would depend on the context of its use, including potential roles in drug development or as a chemical intermediate. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Overall, 1-[2-Amino-4-(trifluoromethyl)phenyl]-3-pyrrolidinol represents a complex structure with diverse implications in chemical research and application.
Formula:C11H13F3N2O
InChI:InChI=1S/C11H13F3N2O/c12-11(13,14)7-1-2-10(9(15)5-7)16-4-3-8(17)6-16/h1-2,5,8,17H,3-4,6,15H2
InChI key:InChIKey=XOYQQINZQPJMTQ-UHFFFAOYSA-N
SMILES:NC1=C(N2CCC(O)C2)C=CC(C(F)(F)F)=C1
Synonyms:
  • 1-[2-Amino-4-(trifluoromethyl)phenyl]-3-pyrrolidinol
  • 3-Pyrrolidinol, 1-[2-amino-4-(trifluoromethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.