CymitQuimica logo

CAS 1220037-36-4

:

N1,4-Dimethyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-1,2-benzenediamine

Description:
N1,4-Dimethyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-1,2-benzenediamine is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with two methyl groups and a tetrahydro-2H-pyran moiety. This compound features two amine functional groups, contributing to its potential as a ligand in coordination chemistry or as a building block in organic synthesis. The presence of the tetrahydro-2H-pyran ring suggests that it may exhibit unique reactivity and solubility properties, particularly in polar solvents. Its molecular structure indicates potential applications in pharmaceuticals or agrochemicals, where such amine-containing compounds are often utilized for their biological activity. Additionally, the compound's specific stereochemistry and functional groups may influence its interaction with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and applications.
Formula:C14H22N2O
InChI:InChI=1S/C14H22N2O/c1-11-3-4-14(13(15)9-11)16(2)10-12-5-7-17-8-6-12/h3-4,9,12H,5-8,10,15H2,1-2H3
InChI key:InChIKey=SAQMUNJREIVRKU-UHFFFAOYSA-N
SMILES:N(CC1CCOCC1)(C)C2=C(N)C=C(C)C=C2
Synonyms:
  • N1,4-Dimethyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-1,2-benzenediamine
  • 1,2-Benzenediamine, N1,4-dimethyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.