CAS 1220037-43-3

Acetamide, 2-amino-N-(3-hydroxybutyl)-, hydrochloride (1:1)

Description:

Acetamide, 2-amino-N-(3-hydroxybutyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from acetic acid. This compound features an amino group and a hydroxybutyl side chain, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of both amino and hydroxyl groups suggests that it may participate in hydrogen bonding, influencing its physical properties such as melting point and solubility. Additionally, the compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, this compound's unique structure positions it as a candidate for further research in drug development and related fields.

Formula: C₆H₁₄N₂O₂·ClH

InChI: InChI=1S/C6H14N2O2.ClH/c1-5(9)2-3-8-6(10)4-7;/h5,9H,2-4,7H2,1H3,(H,8,10);1H

InChI key: InChIKey=ZKWRNZRVRNJFFD-UHFFFAOYSA-N

SMILES: C(NCCC(C)O)(CN)=O.Cl

Synonyms:

• Acetamide, 2-amino-N-(3-hydroxybutyl)-, hydrochloride (1:1)