
CAS 1220037-44-4
:N1,2-Dimethyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-1,4-benzenediamine
Description:
N1,2-Dimethyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-1,4-benzenediamine is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with two methyl groups and a tetrahydro-2H-pyran moiety. This compound features two amine functional groups, which can participate in hydrogen bonding and influence its solubility and reactivity. The presence of the tetrahydro-2H-pyran ring contributes to its cyclic structure, potentially affecting its conformational flexibility and steric interactions. The compound may exhibit properties typical of amines, such as basicity and nucleophilicity, making it relevant in various chemical reactions, including those in medicinal chemistry and organic synthesis. Its specific applications and biological activity would depend on further studies, including pharmacological assessments. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.
Formula:C14H22N2O
InChI:InChI=1S/C14H22N2O/c1-11-9-13(15)3-4-14(11)16(2)10-12-5-7-17-8-6-12/h3-4,9,12H,5-8,10,15H2,1-2H3
InChI key:InChIKey=MUIWQHOJPAXUNM-UHFFFAOYSA-N
SMILES:N(CC1CCOCC1)(C)C2=C(C)C=C(N)C=C2
Synonyms:- 1,4-Benzenediamine, N1,2-dimethyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-
- N1,2-Dimethyl-N1-[(tetrahydro-2H-pyran-4-yl)methyl]-1,4-benzenediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.