CymitQuimica logo

CAS 1220037-45-5

:

Piperidine, 4-[(4-propoxyphenoxy)methyl]-, hydrochloride (1:1)

Description:
Piperidine, 4-[(4-propoxyphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a propoxyphenoxy group attached to the piperidine nitrogen, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the propoxyphenoxy moiety may influence its pharmacokinetic properties, such as absorption and distribution. The compound is likely to exhibit basic characteristics due to the nitrogen atom in the piperidine ring, allowing it to form salts with acids. Its specific applications and effects would depend on its interaction with biological systems, making it of interest in medicinal chemistry and drug development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C15H23NO2·ClH
InChI:InChI=1S/C15H23NO2.ClH/c1-2-11-17-14-3-5-15(6-4-14)18-12-13-7-9-16-10-8-13;/h3-6,13,16H,2,7-12H2,1H3;1H
InChI key:InChIKey=JVZOSKTTWNIYGK-UHFFFAOYSA-N
SMILES:O(CC1CCNCC1)C2=CC=C(OCCC)C=C2.Cl
Synonyms:
  • Piperidine, 4-[(4-propoxyphenoxy)methyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.