CAS 1220037-52-4

Piperidine, 3-[(4-propoxyphenoxy)methyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[(4-propoxyphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a propoxyphenoxy group attached to the piperidine at the 3-position, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the propoxyphenoxy moiety may impart specific pharmacological effects, making it of interest in medicinal chemistry. The compound's structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, this compound exemplifies the diverse functionalities that can be achieved through modifications of the piperidine scaffold.

Formula: C₁₅H₂₃NO₂·ClH

InChI: InChI=1S/C15H23NO2.ClH/c1-2-10-17-14-5-7-15(8-6-14)18-12-13-4-3-9-16-11-13;/h5-8,13,16H,2-4,9-12H2,1H3;1H

InChI key: InChIKey=CKLVLRAWUYVPEZ-UHFFFAOYSA-N

SMILES: O(CC1CCCNC1)C2=CC=C(OCCC)C=C2.Cl

Synonyms:

• Piperidine, 3-[(4-propoxyphenoxy)methyl]-, hydrochloride (1:1)