
CAS 1220037-56-8
:Pyrrolidine, 3-[([1,1′-biphenyl]-4-yloxy)methyl]-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-[([1,1′-biphenyl]-4-yloxy)methyl]-, hydrochloride (1:1), with CAS number 1220037-56-8, is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of a biphenyl moiety, specifically a 4-yloxy substituent, indicates that the compound has potential applications in medicinal chemistry, possibly as a pharmaceutical agent or a research chemical. The hydrochloride form suggests that it is a salt, which typically enhances the solubility and stability of the compound in aqueous solutions. This compound may exhibit various biological activities due to its structural features, making it of interest in drug development. Its properties, such as melting point, solubility, and reactivity, would be influenced by the functional groups present and the overall molecular structure. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.
Formula:C17H19NO·ClH
InChI:InChI=1S/C17H19NO.ClH/c1-2-4-15(5-3-1)16-6-8-17(9-7-16)19-13-14-10-11-18-12-14;/h1-9,14,18H,10-13H2;1H
InChI key:InChIKey=WAVMATWQUCWCCG-UHFFFAOYSA-N
SMILES:O(CC1CCNC1)C2=CC=C(C=C2)C3=CC=CC=C3.Cl
Synonyms:- Pyrrolidine, 3-[([1,1′-biphenyl]-4-yloxy)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.