
CAS 1220037-58-0
:Propanamide, 3-amino-N-(3-methoxypropyl)-, hydrochloride (1:1)
Description:
Propanamide, 3-amino-N-(3-methoxypropyl)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar molecule with hydrogen bonding capabilities. The presence of the amino group suggests that it can act as a base, capable of accepting protons, while the methoxypropyl substituent contributes to its hydrophobic characteristics. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability in pharmaceutical applications. This compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its molecular structure allows for interactions with biological targets, potentially influencing its pharmacological properties. Additionally, the presence of both hydrophilic and hydrophobic regions in its structure may facilitate its interaction with lipid membranes, influencing its absorption and distribution in biological systems. Overall, this compound's unique characteristics make it a subject of interest for further research in drug development and related fields.
Formula:C7H16N2O2·ClH
InChI:InChI=1S/C7H16N2O2.ClH/c1-11-6-2-5-9-7(10)3-4-8;/h2-6,8H2,1H3,(H,9,10);1H
InChI key:InChIKey=QCKKYBUQQWPVFD-UHFFFAOYSA-N
SMILES:C(NCCCOC)(CCN)=O.Cl
Synonyms:- Propanamide, 3-amino-N-(3-methoxypropyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.