CAS 1220037-60-4

Piperidine, 3-[2-(4-propoxyphenoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[2-(4-propoxyphenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a propoxyphenoxyethyl side chain, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the propoxy and phenoxy groups suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure may influence its pharmacokinetics, including absorption, distribution, metabolism, and excretion. Additionally, the hydrochloride form can affect the compound's stability and shelf life. Overall, this substance is likely to exhibit specific characteristics related to its structure, including potential therapeutic effects, but detailed studies would be necessary to elucidate its full biological profile and applications.

Formula: C₁₆H₂₅NO₂·ClH

InChI: InChI=1S/C16H25NO2.ClH/c1-2-11-18-15-5-7-16(8-6-15)19-12-9-14-4-3-10-17-13-14;/h5-8,14,17H,2-4,9-13H2,1H3;1H

InChI key: InChIKey=VSVKOZYBXDVILU-UHFFFAOYSA-N

SMILES: O(CCC1CCCNC1)C2=CC=C(OCCC)C=C2.Cl

Synonyms:

• Piperidine, 3-[2-(4-propoxyphenoxy)ethyl]-, hydrochloride (1:1)