CAS 1220037-64-8

3-Piperidinecarboxamide, N-(2-furanylmethyl)-, hydrochloride (1:1)

Description:

3-Piperidinecarboxamide, N-(2-furanylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of the furanylmethyl substituent indicates that it has a furan ring, which is a five-membered aromatic ring containing oxygen, enhancing its reactivity and potential interactions in biological systems. As a hydrochloride salt, it is typically more soluble in water, which can facilitate its use in various applications, including pharmaceuticals. The compound may exhibit properties such as antimicrobial or anti-inflammatory activities, although specific biological activities would depend on further empirical studies. Its molecular structure suggests potential for interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₁₁H₁₆N₂O₂·ClH

InChI: InChI=1S/C11H16N2O2.ClH/c14-11(9-3-1-5-12-7-9)13-8-10-4-2-6-15-10;/h2,4,6,9,12H,1,3,5,7-8H2,(H,13,14);1H

InChI key: InChIKey=BVYKBZSZMNZVNN-UHFFFAOYSA-N

SMILES: C(NCC1=CC=CO1)(=O)C2CCCNC2.Cl

Synonyms:

• 3-Piperidinecarboxamide, N-(2-furanylmethyl)-, hydrochloride (1:1)