
CAS 1220037-71-7
:Piperidine, 2-[2-[4-(1,1-dimethylpropyl)phenoxy]ethyl]-, hydrochloride (1:1)
Description:
Piperidine, 2-[2-[4-(1,1-dimethylpropyl)phenoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a phenoxy group substituted with a branched alkyl chain, specifically 1,1-dimethylpropyl, enhancing its lipophilicity and potentially influencing its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The presence of the piperidine moiety suggests potential interactions with biological systems, particularly in the context of neurotransmitter modulation. Its structure may confer specific pharmacological properties, making it of interest in medicinal chemistry. Safety data and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Overall, this compound exemplifies the complexity and diversity of organic molecules used in research and industry.
Formula:C18H29NO·ClH
InChI:InChI=1S/C18H29NO.ClH/c1-4-18(2,3)15-8-10-17(11-9-15)20-14-12-16-7-5-6-13-19-16;/h8-11,16,19H,4-7,12-14H2,1-3H3;1H
InChI key:InChIKey=AARFSZYKFUPBQN-UHFFFAOYSA-N
SMILES:C(CC)(C)(C)C1=CC=C(OCCC2CCCCN2)C=C1.Cl
Synonyms:- Piperidine, 2-[2-[4-(1,1-dimethylpropyl)phenoxy]ethyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.