CAS 1220037-73-9

Piperidine, 4-(2-chloro-4-nitrophenoxy)-, hydrochloride (1:1)

Description:

Piperidine, 4-(2-chloro-4-nitrophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocyclic amine. The compound features a 2-chloro-4-nitrophenoxy substituent, indicating the presence of a chlorine atom and a nitro group on a phenolic structure, which contributes to its reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and chemical research. The presence of the nitro group may impart specific electronic properties, influencing the compound's interactions with biological targets. This compound is likely to exhibit moderate to high polarity due to the functional groups present, affecting its distribution and absorption characteristics in biological systems. Safety and handling precautions are essential, as compounds containing nitro groups can be hazardous. Overall, this substance is of interest in medicinal chemistry and may serve as a lead compound for further development.

Formula: C₁₁H₁₃ClN₂O₃·ClH

InChI: InChI=1S/C11H13ClN2O3.ClH/c12-10-7-8(14(15)16)1-2-11(10)17-9-3-5-13-6-4-9;/h1-2,7,9,13H,3-6H2;1H

InChI key: InChIKey=GVXXPVSVLGSBKR-UHFFFAOYSA-N

SMILES: O(C1=C(Cl)C=C(N(=O)=O)C=C1)C2CCNCC2.Cl

Synonyms:

• Piperidine, 4-(2-chloro-4-nitrophenoxy)-, hydrochloride (1:1)