CAS 1220037-75-1

Benzoic acid, 4-methoxy-, 4-piperidinylmethyl ester, hydrochloride (1:1)

Description:

Benzoic acid, 4-methoxy-, 4-piperidinylmethyl ester, hydrochloride (1:1), with the CAS number 1220037-75-1, is a chemical compound characterized by its ester functional group derived from benzoic acid and a piperidine moiety. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols due to the presence of the hydrochloride salt form. The methoxy group enhances its lipophilicity, potentially influencing its biological activity and pharmacokinetics. The piperidine ring contributes to its basicity and may play a role in receptor interactions, making it of interest in medicinal chemistry. Its hydrochloride form indicates that it is a salt, which can affect its stability and solubility profile. As with many organic compounds, it is essential to handle this substance with care, following appropriate safety protocols, as it may exhibit specific biological activities or toxicity. Further studies would be necessary to elucidate its full chemical behavior and potential applications in pharmaceuticals or other fields.

Formula: C₁₄H₁₉NO₃·ClH

InChI: InChI=1S/C14H19NO3.ClH/c1-17-13-4-2-12(3-5-13)14(16)18-10-11-6-8-15-9-7-11;/h2-5,11,15H,6-10H2,1H3;1H

InChI key: InChIKey=IKEMRDCJOGWIQI-UHFFFAOYSA-N

SMILES: C(OCC1CCNCC1)(=O)C2=CC=C(OC)C=C2.Cl

Synonyms:

• Benzoic acid, 4-methoxy-, 4-piperidinylmethyl ester, hydrochloride (1:1)