CAS 1220037-80-8

3-Azetidinol, 3-propanoate

Description:

3-Azetidinol, 3-propanoate, with the CAS number 1220037-80-8, is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. This compound features a hydroxyl group (-OH) and a propanoate moiety, contributing to its potential as a versatile building block in organic synthesis. The presence of the azetidine ring imparts unique reactivity and steric properties, making it of interest in medicinal chemistry and the development of pharmaceuticals. Its molecular structure suggests it may exhibit specific interactions with biological targets, potentially influencing its pharmacological profile. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards. Overall, 3-Azetidinol, 3-propanoate represents a noteworthy compound for further research and application in various chemical and pharmaceutical contexts.

Formula: C₆H₁₁NO₂

InChI: InChI=1S/C6H11NO2/c1-2-6(8)9-5-3-7-4-5/h5,7H,2-4H2,1H3

InChI key: InChIKey=TZGHYXIOSCZIGJ-UHFFFAOYSA-N

SMILES: O(C(CC)=O)C1CNC1

Synonyms:

• 3-Azetidinol, 3-propanoate