CAS 1220037-90-0

Piperidine, 4-[2-(4-nitrophenoxy)ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[2-(4-nitrophenoxy)ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a 4-(2-(4-nitrophenoxy)ethyl) substituent, indicating the presence of a nitrophenoxy group attached to an ethyl chain at the 4-position of the piperidine ring. The hydrochloride designation signifies that the compound is in its salt form, typically enhancing its solubility in water and stability. The nitro group on the phenoxy moiety contributes to the compound's potential reactivity and biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of the piperidine structure often correlates with various pharmacological properties, including analgesic and anti-inflammatory effects. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity associated with nitro compounds. Overall, this compound's unique structure suggests potential applications in drug development and research.

Formula: C₁₃H₁₈N₂O₃·ClH

InChI: InChI=1S/C13H18N2O3.ClH/c16-15(17)12-1-3-13(4-2-12)18-10-7-11-5-8-14-9-6-11;/h1-4,11,14H,5-10H2;1H

InChI key: InChIKey=CWJHUKYOSWLCSX-UHFFFAOYSA-N

SMILES: O(CCC1CCNCC1)C2=CC=C(N(=O)=O)C=C2.Cl

Synonyms:

• Piperidine, 4-[2-(4-nitrophenoxy)ethyl]-, hydrochloride (1:1)