CymitQuimica logo

CAS 1220037-95-5

:

2-[(3-Hydroxypropyl)amino]-3-pyridinecarboxylic acid

Description:
2-[(3-Hydroxypropyl)amino]-3-pyridinecarboxylic acid, identified by its CAS number 1220037-95-5, is an organic compound featuring a pyridine ring substituted with a carboxylic acid group and an amino group linked to a hydroxypropyl chain. This compound exhibits characteristics typical of both amino acids and pyridine derivatives, including potential solubility in polar solvents due to the presence of the hydroxyl and carboxylic acid functional groups. The amino group can participate in hydrogen bonding, enhancing its reactivity and interaction with biological systems. Its structure suggests it may have applications in pharmaceuticals or biochemistry, particularly in the development of compounds that interact with biological targets. Additionally, the presence of the hydroxyl group may confer additional properties such as increased hydrophilicity. Overall, this compound's unique structural features make it a subject of interest for further research in medicinal chemistry and related fields.
Formula:C9H12N2O3
InChI:InChI=1S/C9H12N2O3/c12-6-2-5-11-8-7(9(13)14)3-1-4-10-8/h1,3-4,12H,2,5-6H2,(H,10,11)(H,13,14)
InChI key:InChIKey=UAIGELSUKBKTRV-UHFFFAOYSA-N
SMILES:N(CCCO)C1=C(C(O)=O)C=CC=N1
Synonyms:
  • 2-[(3-Hydroxypropyl)amino]-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 2-[(3-hydroxypropyl)amino]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.