CAS 1220038-04-9
:Ethyl 3-amino-4-[(2-hydroxy-1,1-dimethylethyl)amino]benzoate
Description:
Ethyl 3-amino-4-[(2-hydroxy-1,1-dimethylethyl)amino]benzoate, identified by its CAS number 1220038-04-9, is a chemical compound characterized by its complex structure, which includes an ethyl ester group, an amino group, and a hydroxy-substituted dimethylamino moiety. This compound typically exhibits properties associated with both amines and esters, such as potential solubility in organic solvents and moderate polarity. The presence of the amino group suggests it may participate in hydrogen bonding, influencing its reactivity and interaction with biological systems. Additionally, the hydroxy group contributes to its potential as a hydrogen bond donor or acceptor, which can affect its pharmacological properties. Ethyl 3-amino-4-[(2-hydroxy-1,1-dimethylethyl)amino]benzoate may be of interest in medicinal chemistry due to its structural features that could lead to biological activity, making it a candidate for further research in drug development or as a biochemical probe. However, specific applications and biological effects would require empirical studies to elucidate its behavior in various environments.
Formula:C13H20N2O3
InChI:InChI=1S/C13H20N2O3/c1-4-18-12(17)9-5-6-11(10(14)7-9)15-13(2,3)8-16/h5-7,15-16H,4,8,14H2,1-3H3
InChI key:InChIKey=SVFUMRXDAUUMEF-UHFFFAOYSA-N
SMILES:N(C(CO)(C)C)C1=C(N)C=C(C(OCC)=O)C=C1
Synonyms:- Benzoic acid, 3-amino-4-[(2-hydroxy-1,1-dimethylethyl)amino]-, ethyl ester
- Ethyl 3-amino-4-[(2-hydroxy-1,1-dimethylethyl)amino]benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.