CAS 1220038-09-4

Pyrrolidine, 3-[(4-bromo-2-methylphenoxy)methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 3-[(4-bromo-2-methylphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of the 4-bromo-2-methylphenoxy group indicates that it has a phenolic structure with a bromine substituent and a methyl group, contributing to its unique chemical properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry. Its molecular interactions can be influenced by the bromine atom, which can affect the compound's reactivity and binding affinity in biological systems. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential pharmacological effects. Further studies would be necessary to fully elucidate its properties, including its stability, reactivity, and potential applications.

Formula: C₁₂H₁₆BrNO·ClH

InChI: InChI=1S/C12H16BrNO.ClH/c1-9-6-11(13)2-3-12(9)15-8-10-4-5-14-7-10;/h2-3,6,10,14H,4-5,7-8H2,1H3;1H

InChI key: InChIKey=WXYXOLIKJBLNMC-UHFFFAOYSA-N

SMILES: O(CC1CCNC1)C2=C(C)C=C(Br)C=C2.Cl

Synonyms:

• Pyrrolidine, 3-[(4-bromo-2-methylphenoxy)methyl]-, hydrochloride (1:1)