CAS 1220038-10-7

Cyclopropanecarboxylic acid, 3-piperidinyl ester, hydrochloride (1:1)

Description:

Cyclopropanecarboxylic acid, 3-piperidinyl ester, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a piperidine moiety. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. The presence of the cyclopropanecarboxylic acid component contributes to its potential reactivity, particularly in organic synthesis and medicinal chemistry. The piperidine ring is known for its basicity and ability to participate in various chemical reactions, making this compound of interest in pharmaceutical applications. Additionally, the hydrochloride form often improves the stability and handling of the compound in laboratory settings. Overall, this substance may exhibit biological activity, warranting further investigation for potential therapeutic uses, although specific biological properties would require empirical studies to elucidate.

Formula: C₉H₁₅NO₂·ClH

InChI: InChI=1S/C9H15NO2.ClH/c11-9(7-3-4-7)12-8-2-1-5-10-6-8;/h7-8,10H,1-6H2;1H

InChI key: InChIKey=DKNMNFLZCSQBDL-UHFFFAOYSA-N

SMILES: C(OC1CCCNC1)(=O)C2CC2.Cl

Synonyms:

• Cyclopropanecarboxylic acid, 3-piperidinyl ester, hydrochloride (1:1)