CAS 1220038-13-0

Acetamide, N-(3-ethoxypropyl)-2-(methylamino)-, hydrochloride (1:1)

Description:

Acetamide, N-(3-ethoxypropyl)-2-(methylamino)-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar solvent and its ability to participate in hydrogen bonding. This compound features an ethoxypropyl side chain, contributing to its hydrophobic characteristics, while the methylamino group enhances its basicity and potential for interaction with biological systems. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceuticals. The presence of both hydrophilic and hydrophobic components suggests that it may exhibit amphiphilic properties, making it suitable for use in drug formulation and delivery systems. Additionally, the compound's structure may influence its pharmacokinetic properties, such as absorption and distribution in biological systems. Safety and handling precautions should be observed, as with all chemical substances, particularly in laboratory or industrial settings.

Formula: C₈H₁₈N₂O₂·ClH

InChI: InChI=1S/C8H18N2O2.ClH/c1-3-12-6-4-5-10-8(11)7-9-2;/h9H,3-7H2,1-2H3,(H,10,11);1H

InChI key: InChIKey=MUCQGGRTUYRZLY-UHFFFAOYSA-N

SMILES: C(NCCCOCC)(CNC)=O.Cl

Synonyms:

• Acetamide, N-(3-ethoxypropyl)-2-(methylamino)-, hydrochloride (1:1)