CAS 1220038-19-6
:2-[(6-Chloro-2-pyrazinyl)amino]-2-methyl-1-propanol
Description:
2-[(6-Chloro-2-pyrazinyl)amino]-2-methyl-1-propanol is a chemical compound characterized by its unique structure, which includes a pyrazine ring substituted with a chlorine atom and an amino group. This compound features a tertiary alcohol due to the presence of the hydroxyl (-OH) group attached to a carbon that is also bonded to a methyl group and an amino-substituted pyrazine moiety. The presence of the chlorine atom contributes to its potential reactivity and biological activity. The compound may exhibit properties such as solubility in polar solvents, and its functional groups suggest potential interactions in biological systems, making it of interest in medicinal chemistry. Additionally, the pyrazine ring can influence the compound's electronic properties and stability. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C8H12ClN3O
InChI:InChI=1S/C8H12ClN3O/c1-8(2,5-13)12-7-4-10-3-6(9)11-7/h3-4,13H,5H2,1-2H3,(H,11,12)
InChI key:InChIKey=PSRYNULFXOLKLB-UHFFFAOYSA-N
SMILES:N(C(CO)(C)C)C1=NC(Cl)=CN=C1
Synonyms:- 1-Propanol, 2-[(6-chloro-2-pyrazinyl)amino]-2-methyl-
- 2-[(6-Chloro-2-pyrazinyl)amino]-2-methyl-1-propanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.