
CAS 1220038-23-2
:Cyclopropanecarboxylic acid, 2-(4-piperidinyl)ethyl ester, hydrochloride (1:1)
Description:
Cyclopropanecarboxylic acid, 2-(4-piperidinyl)ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and a piperidine moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydrochloride salt form. The piperidine group contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly for its possible effects on the central nervous system. The ester functional group indicates that it may undergo hydrolysis under certain conditions, releasing the corresponding acid and alcohol. As with many organic compounds, it is essential to handle this substance with care, following appropriate safety protocols, as it may exhibit toxicity or irritant properties. Its specific applications and effects would depend on further research and characterization, particularly in pharmacological contexts.
Formula:C11H19NO2·ClH
InChI:InChI=1S/C11H19NO2.ClH/c13-11(10-1-2-10)14-8-5-9-3-6-12-7-4-9;/h9-10,12H,1-8H2;1H
InChI key:InChIKey=VFYHUPGOZTTYKG-UHFFFAOYSA-N
SMILES:C(OCCC1CCNCC1)(=O)C2CC2.Cl
Synonyms:- Cyclopropanecarboxylic acid, 2-(4-piperidinyl)ethyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.