CAS 1220038-25-4

Piperidine, 2-methyl-1-[2-(3-piperidinyl)ethyl]-, hydrochloride (1:2)

Description:

Piperidine, 2-methyl-1-[2-(3-piperidinyl)ethyl]-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This compound features a 2-methyl group and a side chain that includes another piperidine moiety, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of multiple piperidine units suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Additionally, the compound's basicity due to the nitrogen atoms in the piperidine rings can affect its reactivity and interaction with other chemical species. Overall, this compound's unique structural features position it as a candidate for further research in drug development and related fields.

Formula: C₁₃H₂₆N₂·2ClH

InChI: InChI=1S/C13H26N2.2ClH/c1-12-5-2-3-9-15(12)10-7-13-6-4-8-14-11-13;;/h12-14H,2-11H2,1H3;2*1H

InChI key: InChIKey=LKIWNCZOULEFSL-UHFFFAOYSA-N

SMILES: C(CC1CCCNC1)N2C(C)CCCC2.Cl

Synonyms:

• Piperidine, 2-methyl-1-[2-(3-piperidinyl)ethyl]-, hydrochloride (1:2)