CAS 1220038-38-9

N-(6-Chloro-2-pyridinyl)-3-pyridinemethanamine

Description:

N-(6-Chloro-2-pyridinyl)-3-pyridinemethanamine, identified by its CAS number 1220038-38-9, is a chemical compound characterized by its pyridine-based structure, which includes a chloro substituent. This compound typically exhibits properties associated with amines and heterocyclic compounds, such as basicity due to the presence of nitrogen atoms in the pyridine rings. The chloro group can influence its reactivity and solubility, potentially enhancing its interaction with biological targets. It may be utilized in pharmaceutical research, particularly in the development of compounds with potential therapeutic applications. The presence of multiple nitrogen atoms in its structure suggests that it may participate in hydrogen bonding, affecting its physical properties like melting and boiling points. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the chloro substituent and the overall molecular conformation. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.

Formula: C₁₁H₁₀ClN₃

InChI: InChI=1S/C11H10ClN3/c12-10-4-1-5-11(15-10)14-8-9-3-2-6-13-7-9/h1-7H,8H2,(H,14,15)

InChI key: InChIKey=HVZXGXWRRVBSFA-UHFFFAOYSA-N

SMILES: N(CC=1C=CC=NC1)C=2N=C(Cl)C=CC2

Synonyms:

• 3-Pyridinemethanamine, N-(6-chloro-2-pyridinyl)-
• N-(6-Chloro-2-pyridinyl)-3-pyridinemethanamine

6-Chloro-N-[(pyridin-3-yl)methyl]pyridin-2-amine

CAS: 1220038-38-9

Versatile small molecule scaffold

Formula: C₁₁H₁₀ClN₃

Purity: Min. 95%

Molecular weight: 219.67 g/mol

Ref: 3D-VYB03838