
CAS 1220038-56-1
:4-Piperidineethanamine, N-butyl-N-methyl-, hydrochloride (1:2)
Description:
4-Piperidineethanamine, N-butyl-N-methyl-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential biological activity. This substance is a hydrochloride salt, indicating that it is a protonated form of the base, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical formulations. The presence of both butyl and methyl groups on the nitrogen atom of the piperidine ring suggests that it may exhibit unique pharmacological properties, potentially influencing its interaction with biological targets. The compound's molecular structure allows for flexibility and steric effects, which can affect its binding affinity and efficacy. Additionally, as a hydrochloride salt, it is likely to be stable under standard storage conditions, although specific handling and safety measures should be observed due to its potential biological activity. Overall, this compound may be of interest in medicinal chemistry and drug development, warranting further investigation into its properties and applications.
Formula:C12H26N2·2ClH
InChI:InChI=1S/C12H26N2.2ClH/c1-3-4-10-14(2)11-7-12-5-8-13-9-6-12;;/h12-13H,3-11H2,1-2H3;2*1H
InChI key:InChIKey=JCUCTSWQFCTQPB-UHFFFAOYSA-N
SMILES:C(CN(CCCC)C)C1CCNCC1.Cl
Synonyms:- 4-Piperidineethanamine, N-butyl-N-methyl-, hydrochloride (1:2)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.