CymitQuimica logo

CAS 1220038-59-4

:

2-Cyclopropyl-3,5,6,7-tetrahydro-4H-pyrrolo[3,4-d]pyrimidin-4-one

Description:
2-Cyclopropyl-3,5,6,7-tetrahydro-4H-pyrrolo[3,4-d]pyrimidin-4-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine rings. This compound features a cyclopropyl group, contributing to its distinct chemical properties and potential reactivity. The presence of the tetrahydro configuration indicates that the compound is saturated, which can influence its stability and interactions with other molecules. Typically, such compounds may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The specific arrangement of functional groups and the bicyclic nature can affect the compound's solubility, polarity, and binding affinity to biological targets. Additionally, the compound's CAS number, 1220038-59-4, allows for precise identification and retrieval of information in chemical databases. Overall, 2-Cyclopropyl-3,5,6,7-tetrahydro-4H-pyrrolo[3,4-d]pyrimidin-4-one represents a class of compounds that may have significant implications in pharmaceutical research and development.
Formula:C9H11N3O
InChI:InChI=1S/C9H11N3O/c13-9-6-3-10-4-7(6)11-8(12-9)5-1-2-5/h5,10H,1-4H2,(H,11,12,13)
InChI key:InChIKey=OIQUBDUTWLXJCX-UHFFFAOYSA-N
SMILES:O=C1C2=C(NC(=N1)C3CC3)CNC2
Synonyms:
  • 4H-Pyrrolo[3,4-d]pyrimidin-4-one, 2-cyclopropyl-3,5,6,7-tetrahydro-
  • 2-Cyclopropyl-3,5,6,7-tetrahydro-4H-pyrrolo[3,4-d]pyrimidin-4-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.