
CAS 1220038-60-7
:Piperazine, 1-(phenylmethyl)-4-[2-(4-piperidinyl)ethyl]-, hydrochloride (1:2)
Description:
Piperazine, 1-(phenylmethyl)-4-[2-(4-piperidinyl)ethyl]-, hydrochloride (1:2) is a chemical compound characterized by its complex structure, which includes a piperazine ring and a phenylmethyl group. This substance is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals. The presence of the piperidine moiety contributes to its potential biological activity, often associated with central nervous system effects. The compound may exhibit properties such as anxiolytic or antidepressant effects, although specific pharmacological profiles would depend on further empirical studies. Its molecular interactions are influenced by the functional groups present, which can affect its binding affinity to various receptors. As with many piperazine derivatives, safety and toxicity profiles are essential considerations in its application, necessitating thorough evaluation in both laboratory and clinical settings. Overall, this compound represents a significant interest in medicinal chemistry, particularly in the development of therapeutic agents targeting neurological disorders.
Formula:C18H30ClN3
InChI:InChI=1S/C18H29N3.2ClH/c1-2-4-18(5-3-1)16-21-14-12-20(13-15-21)11-8-17-6-9-19-10-7-17;;/h1-5,17,19H,6-16H2;2*1H
InChI key:InChIKey=YHNFUFOVJIALDY-UHFFFAOYSA-N
SMILES:C(N1CCN(CCC2CCNCC2)CC1)C3=CC=CC=C3.Cl
Synonyms:- Piperazine, 1-(phenylmethyl)-4-[2-(4-piperidinyl)ethyl]-, hydrochloride (1:2)
- 1-Benzyl-4-[2-(4-piperidinyl)ethyl]piperazinedihydrochloride
- 1-BENZYL-4-(2-(PIPERIDIN-4-YL)ETHYL)PIPERAZINE DIHYDROCHLORIDE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.