CAS 1220038-65-2
:3-(2-Cyclohexylethoxy)azetidine
Description:
3-(2-Cyclohexylethoxy)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The presence of the 2-cyclohexylethoxy group introduces a hydrophobic character to the molecule, influencing its solubility and potential interactions in biological systems. This compound may exhibit interesting pharmacological properties due to its unique structure, which can affect its reactivity and binding affinity to biological targets. The azetidine ring can participate in various chemical reactions, including nucleophilic substitutions and ring-opening reactions, making it a versatile building block in organic synthesis. Additionally, the steric bulk of the cyclohexyl group may impact the compound's conformational flexibility and overall stability. As with many organic compounds, the specific characteristics such as melting point, boiling point, and reactivity can vary based on environmental conditions and the presence of other functional groups. Further studies would be necessary to fully elucidate its properties and potential applications in medicinal chemistry or materials science.
Formula:C11H21NO
InChI:InChI=1S/C11H21NO/c1-2-4-10(5-3-1)6-7-13-11-8-12-9-11/h10-12H,1-9H2
InChI key:InChIKey=GWJNIZTXBCLCQH-UHFFFAOYSA-N
SMILES:O(CCC1CCCCC1)C2CNC2
Synonyms:- Azetidine, 3-(2-cyclohexylethoxy)-
- 3-(2-Cyclohexylethoxy)azetidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.