CAS 1220038-68-5

3-(2-Phenoxyethoxy)azetidine

Description:

3-(2-Phenoxyethoxy)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The compound features a phenoxyethoxy substituent, indicating the presence of a phenyl group connected through an ether linkage to an ethylene glycol moiety. This structure contributes to its potential solubility in organic solvents and may influence its reactivity and interaction with biological systems. The presence of the azetidine ring suggests potential applications in medicinal chemistry, as such compounds can exhibit interesting pharmacological properties. Additionally, the specific arrangement of functional groups may affect the compound's polarity, stability, and ability to participate in various chemical reactions. As with many organic compounds, the characteristics such as melting point, boiling point, and spectral properties (NMR, IR, etc.) would be essential for further understanding its behavior and applications in research and industry. Safety data and handling precautions should also be considered when working with this substance.

Formula: C₁₁H₁₅NO₂

InChI: InChI=1S/C11H15NO2/c1-2-4-10(5-3-1)13-6-7-14-11-8-12-9-11/h1-5,11-12H,6-9H2

InChI key: InChIKey=NWAPGELSMDJYAR-UHFFFAOYSA-N

SMILES: O(CCOC1=CC=CC=C1)C2CNC2

Synonyms:

• Azetidine, 3-(2-phenoxyethoxy)-
• 3-(2-Phenoxyethoxy)azetidine