
CAS 1220038-73-2
:3-(3-Methylbutoxy)azetidine
Description:
3-(3-Methylbutoxy)azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The presence of the 3-methylbutoxy group introduces a branched alkyl chain, contributing to the compound's overall hydrophobic character. This structure can influence its solubility, reactivity, and potential applications in various fields, including pharmaceuticals and materials science. The azetidine ring is known for its potential biological activity, making compounds like 3-(3-Methylbutoxy)azetidine of interest in medicinal chemistry. Additionally, the specific arrangement of substituents can affect the compound's stereochemistry, which may play a crucial role in its interaction with biological targets. As with many organic compounds, the physical properties such as boiling point, melting point, and density would depend on the molecular interactions and the presence of functional groups. Overall, 3-(3-Methylbutoxy)azetidine represents a unique structure that may offer diverse chemical behavior and applications.
Formula:C8H17NO
InChI:InChI=1S/C8H17NO/c1-7(2)3-4-10-8-5-9-6-8/h7-9H,3-6H2,1-2H3
InChI key:InChIKey=AALWIFFNQKVWPA-UHFFFAOYSA-N
SMILES:O(CCC(C)C)C1CNC1
Synonyms:- Azetidine, 3-(3-methylbutoxy)-
- 3-(3-Methylbutoxy)azetidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.