CAS 1220038-75-4

Azetidine, 3-[(2,4-dichlorophenyl)methoxy]-

Description:

Azetidine, 3-[(2,4-dichlorophenyl)methoxy]- is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of the 2,4-dichlorophenyl group indicates that the compound has two chlorine substituents on a phenyl ring, which can significantly influence its chemical properties, including reactivity and biological activity. The methoxy group (-OCH3) attached to the phenyl ring enhances the compound's solubility and can affect its interaction with biological targets. This compound may exhibit interesting pharmacological properties due to its unique structural features, making it a subject of interest in medicinal chemistry. Its specific applications and behavior in biological systems would depend on further studies, including its synthesis, stability, and potential therapeutic effects. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine atoms, which can impart toxicity.

Formula: C₁₀H₁₁Cl₂NO

InChI: InChI=1S/C10H11Cl2NO/c11-8-2-1-7(10(12)3-8)6-14-9-4-13-5-9/h1-3,9,13H,4-6H2

InChI key: InChIKey=AMEWSFLQLUMBRG-UHFFFAOYSA-N

SMILES: C(OC1CNC1)C2=C(Cl)C=C(Cl)C=C2

Synonyms:

• Azetidine, 3-[(2,4-dichlorophenyl)methoxy]-
• 3-[(2,4-Dichlorophenyl)methoxy]azetidine