CAS 1220038-76-5
:5-Bromo-N-cyclohexyl-N-ethyl-2-pyridinamine
Description:
5-Bromo-N-cyclohexyl-N-ethyl-2-pyridinamine is an organic compound characterized by its bromine substituent and its amine functional groups. It features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its basicity and potential for hydrogen bonding. The presence of the cyclohexyl and ethyl groups enhances its hydrophobic character, influencing its solubility and interaction with biological systems. This compound may exhibit properties typical of amines, such as nucleophilicity and the ability to form salts with acids. Its bromine atom can participate in various chemical reactions, including substitution and coupling reactions, making it a versatile intermediate in organic synthesis. Additionally, the structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the pyridine moiety, which is often found in biologically active compounds. Overall, 5-Bromo-N-cyclohexyl-N-ethyl-2-pyridinamine is a compound of interest for further research in both synthetic and medicinal chemistry contexts.
Formula:C13H19BrN2
InChI:InChI=1S/C13H19BrN2/c1-2-16(12-6-4-3-5-7-12)13-9-8-11(14)10-15-13/h8-10,12H,2-7H2,1H3
InChI key:InChIKey=SXNIEIBSIQCADC-UHFFFAOYSA-N
SMILES:N(CC)(C1=CC=C(Br)C=N1)C2CCCCC2
Synonyms:- 5-Bromo-N-cyclohexyl-N-ethyl-2-pyridinamine
- 2-Pyridinamine, 5-bromo-N-cyclohexyl-N-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.