CAS 1220038-88-9

Piperidine, 3-[2-[(4-bromophenyl)methoxy]ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 3-[2-[(4-bromophenyl)methoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a 4-bromophenyl group attached via a methoxyethyl linker, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the bromine atom on the phenyl ring may influence its reactivity and interaction with biological targets. This compound may exhibit properties such as analgesic or psychoactive effects, depending on its specific interactions within biological systems. Its molecular structure suggests potential for use in medicinal chemistry, particularly in the development of new therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.

Formula: C₁₄H₂₀BrNO·ClH

InChI: InChI=1S/C14H20BrNO.ClH/c15-14-5-3-13(4-6-14)11-17-9-7-12-2-1-8-16-10-12;/h3-6,12,16H,1-2,7-11H2;1H

InChI key: InChIKey=NJQJDCVLRHQZJH-UHFFFAOYSA-N

SMILES: C(OCCC1CCCNC1)C2=CC=C(Br)C=C2.Cl

Synonyms:

• Piperidine, 3-[2-[(4-bromophenyl)methoxy]ethyl]-, hydrochloride (1:1)
• 3-{2-[(4-Bromobenzyl)oxy]ethyl}piperidinehydrochloride