CAS 1220038-91-4

Piperidine, 4-[2-[(3-methoxyphenyl)methoxy]ethyl]-, hydrochloride (1:1)

Description:

Piperidine, 4-[2-[(3-methoxyphenyl)methoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a substituent that includes a methoxyphenyl group linked through an ethylene bridge, contributing to its unique properties. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its solubility in water and facilitates its use in various applications, particularly in pharmaceutical contexts. The presence of the methoxy group can influence the compound's lipophilicity and biological activity, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which may be explored for therapeutic purposes. Safety and handling precautions are essential, as with all chemical substances, due to potential toxicity or reactivity. Overall, this compound exemplifies the complexity and diversity of organic molecules used in research and development.

Formula: C₁₅H₂₃NO₂·ClH

InChI: InChI=1S/C15H23NO2.ClH/c1-17-15-4-2-3-14(11-15)12-18-10-7-13-5-8-16-9-6-13;/h2-4,11,13,16H,5-10,12H2,1H3;1H

InChI key: InChIKey=JERWZOVWDVHROH-UHFFFAOYSA-N

SMILES: C(OCCC1CCNCC1)C2=CC(OC)=CC=C2.Cl

Synonyms:

• Piperidine, 4-[2-[(3-methoxyphenyl)methoxy]ethyl]-, hydrochloride (1:1)