CymitQuimica logo

CAS 1220038-98-1

:

Piperidine, 2-[2-[(4-methoxyphenyl)methoxy]ethyl]-, hydrochloride (1:1)

Description:
Piperidine, 2-[2-[(4-methoxyphenyl)methoxy]ethyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. This compound features a methoxyphenyl group, indicating the presence of a methoxy substituent on a phenyl ring, which is further connected to an ethyl chain. The hydrochloride designation signifies that the compound is in its salt form, typically enhancing its solubility in water and stability. As a piperidine derivative, it may exhibit properties such as basicity due to the nitrogen atom, which can participate in protonation. The presence of the methoxy group can influence its electronic properties and reactivity, potentially affecting its biological activity. Compounds of this nature are often studied for their pharmacological potential, particularly in the fields of medicinal chemistry and drug development. However, specific biological activities and applications would require further investigation and characterization through empirical studies.
Formula:C15H23NO2·ClH
InChI:InChI=1S/C15H23NO2.ClH/c1-17-15-7-5-13(6-8-15)12-18-11-9-14-4-2-3-10-16-14;/h5-8,14,16H,2-4,9-12H2,1H3;1H
InChI key:InChIKey=ZYXXXPRKFSPBSB-UHFFFAOYSA-N
SMILES:C(OCCC1CCCCN1)C2=CC=C(OC)C=C2.Cl
Synonyms:
  • Piperidine, 2-[2-[(4-methoxyphenyl)methoxy]ethyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.