
CAS 1220039-00-8
:Pyrazine, 2-chloro-6-[2-(2-piperidinyl)ethoxy]-, hydrochloride (1:1)
Description:
Pyrazine, 2-chloro-6-[2-(2-piperidinyl)ethoxy]-, hydrochloride (1:1) is a chemical compound characterized by its pyrazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a chlorine substituent at the 2-position and an ethoxy group linked to a piperidine moiety at the 6-position contributes to its unique chemical properties. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacological activity. The piperidine group suggests potential interactions with biological systems, making it of interest in medicinal chemistry. Its structure may confer specific reactivity patterns, including nucleophilic substitution and electrophilic aromatic substitution, depending on the reaction conditions. The compound's molecular interactions, stability, and potential applications in drug development or as a research chemical are areas of ongoing investigation. As with many chemical substances, safety data and handling precautions are essential due to potential toxicity or reactivity.
Formula:C11H16ClN3O·ClH
InChI:InChI=1S/C11H16ClN3O.ClH/c12-10-7-13-8-11(15-10)16-6-4-9-3-1-2-5-14-9;/h7-9,14H,1-6H2;1H
InChI key:InChIKey=VUORNDPUTMBJJC-UHFFFAOYSA-N
SMILES:O(CCC1CCCCN1)C2=NC(Cl)=CN=C2.Cl
Synonyms:- Pyrazine, 2-chloro-6-[2-(2-piperidinyl)ethoxy]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.