CAS 1220039-09-7

Methanone, (4-hydroxy-1-piperidinyl)-4-piperidinyl-, hydrochloride (1:1)

Description:

Methanone, (4-hydroxy-1-piperidinyl)-4-piperidinyl-, hydrochloride (1:1), identified by CAS number 1220039-09-7, is a chemical compound that features a piperidine structure, which is a six-membered ring containing nitrogen. This compound is characterized by the presence of a methanone functional group and hydroxyl (-OH) group, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its utility in pharmaceutical applications. The piperidine rings suggest that this compound may exhibit properties relevant to central nervous system activity, making it of interest in medicinal chemistry. Its specific interactions, stability, and reactivity would depend on the surrounding conditions, such as pH and temperature. Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential pharmacological effects. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including drug development and therapeutic research.

Formula: C₁₁H₂₀N₂O₂·ClH

InChI: InChI=1S/C11H20N2O2.ClH/c14-10-3-7-13(8-4-10)11(15)9-1-5-12-6-2-9;/h9-10,12,14H,1-8H2;1H

InChI key: InChIKey=KVLPZAWTKXWCPZ-UHFFFAOYSA-N

SMILES: C(=O)(N1CCC(O)CC1)C2CCNCC2.Cl

Synonyms:

• Methanone, (4-hydroxy-1-piperidinyl)-4-piperidinyl-, hydrochloride (1:1)