
CAS 1220039-13-3
:Pyrrolidine, 3-[(2-chloro-4-ethylphenoxy)methyl]-, hydrochloride (1:1)
Description:
Pyrrolidine, 3-[(2-chloro-4-ethylphenoxy)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered saturated heterocyclic amine. The presence of the 2-chloro-4-ethylphenoxy group indicates that it has a phenolic structure with a chlorine substituent and an ethyl group, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its potential applications in pharmaceutical formulations. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry. Its molecular interactions can be influenced by the presence of the chlorine atom and the ethyl group, which may affect its pharmacokinetics and pharmacodynamics. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its properties, potential uses, and any associated risks.
Formula:C13H18ClNO·ClH
InChI:InChI=1S/C13H18ClNO.ClH/c1-2-10-3-4-13(12(14)7-10)16-9-11-5-6-15-8-11;/h3-4,7,11,15H,2,5-6,8-9H2,1H3;1H
InChI key:InChIKey=VJVADRYRPXIJDK-UHFFFAOYSA-N
SMILES:O(CC1CCNC1)C2=C(Cl)C=C(CC)C=C2.Cl
Synonyms:- Pyrrolidine, 3-[(2-chloro-4-ethylphenoxy)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.