CAS 1220039-16-6

4-Piperidinecarboxamide, N-cyclohexyl-N-ethyl-, hydrochloride (1:1)

Description:

4-Piperidinecarboxamide, N-cyclohexyl-N-ethyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a carboxamide functional group, contributing to its potential as a pharmacological agent. The presence of cyclohexyl and ethyl substituents on the nitrogen atom enhances its lipophilicity, which may influence its biological activity and solubility properties. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, making it suitable for various applications, including medicinal chemistry. The compound's molecular interactions may be significant in drug design, particularly in targeting specific receptors or enzymes. Its CAS number, 1220039-16-6, allows for precise identification in chemical databases. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Further studies would be necessary to elucidate its specific biological activities and therapeutic potential.

Formula: C₁₄H₂₆N₂O·ClH

InChI: InChI=1S/C14H26N2O.ClH/c1-2-16(13-6-4-3-5-7-13)14(17)12-8-10-15-11-9-12;/h12-13,15H,2-11H2,1H3;1H

InChI key: InChIKey=JBZAOSPGDJJQIU-UHFFFAOYSA-N

SMILES: N(C(=O)C1CCNCC1)(CC)C2CCCCC2.Cl

Synonyms:

• 4-Piperidinecarboxamide, N-cyclohexyl-N-ethyl-, hydrochloride (1:1)

N-Cyclohexyl-N-ethyl-4-piperidinecarboxamide

CAS: 1220039-16-6

Versatile small molecule scaffold

Formula: C₁₄H₂₇ClN₂O

Purity: Min. 95%

Molecular weight: 274.83 g/mol

Ref: 3D-VYB03916