CAS 1220039-19-9

5-(4-Methyl-1-piperidinyl)-2-(methylsulfonyl)benzenamine

Description:

5-(4-Methyl-1-piperidinyl)-2-(methylsulfonyl)benzenamine, with the CAS number 1220039-19-9, is a chemical compound characterized by its complex structure that includes a piperidine ring and a methylsulfonyl group attached to a benzene ring. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. The presence of the methylsulfonyl group enhances its solubility in polar solvents and may influence its reactivity and biological activity. The piperidine moiety contributes to its potential pharmacological properties, making it of interest in medicinal chemistry. Compounds of this nature are often investigated for their roles in drug development, particularly in the context of neuropharmacology or as potential therapeutic agents. Its specific interactions, stability, and reactivity would depend on the surrounding conditions, such as pH and temperature, as well as the presence of other chemical species. Overall, this compound represents a class of organic molecules with significant implications in various chemical and biological applications.

Formula: C₁₃H₂₀N₂O₂S

InChI: InChI=1S/C13H20N2O2S/c1-10-5-7-15(8-6-10)11-3-4-13(12(14)9-11)18(2,16)17/h3-4,9-10H,5-8,14H2,1-2H3

InChI key: InChIKey=LYDKWTZGNRJDPJ-UHFFFAOYSA-N

SMILES: NC=1C=C(C=CC1S(C)(=O)=O)N2CCC(C)CC2

Synonyms:

• Benzenamine, 5-(4-methyl-1-piperidinyl)-2-(methylsulfonyl)-
• 5-(4-Methyl-1-piperidinyl)-2-(methylsulfonyl)benzenamine