
CAS 1220039-27-9
:2-Amino-5-fluoro-N,N-di-2-propen-1-ylbenzenemethanamine
Description:
2-Amino-5-fluoro-N,N-di-2-propen-1-ylbenzenemethanamine, identified by its CAS number 1220039-27-9, is a chemical compound characterized by its unique structure that includes an amino group, a fluorine atom, and a di-2-propen-1-yl substituent on a benzene ring. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of the fluorine atom may enhance its lipophilicity and alter its electronic properties, potentially affecting its biological activity. The di-2-propen-1-yl group introduces unsaturation, which can lead to additional reactivity, particularly in polymerization or cross-linking reactions. Overall, the characteristics of this compound suggest potential applications in pharmaceuticals or materials science, although specific data on its physical and chemical properties, such as melting point, boiling point, and reactivity, would require further investigation or experimental determination.
Formula:C13H17FN2
InChI:InChI=1S/C13H17FN2/c1-3-7-16(8-4-2)10-11-9-12(14)5-6-13(11)15/h3-6,9H,1-2,7-8,10,15H2
InChI key:InChIKey=CUAMLMXCEOPSIJ-UHFFFAOYSA-N
SMILES:C(N(CC=C)CC=C)C1=C(N)C=CC(F)=C1
Synonyms:- 2-Amino-5-fluoro-N,N-di-2-propen-1-ylbenzenemethanamine
- Benzenemethanamine, 2-amino-5-fluoro-N,N-di-2-propen-1-yl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.