CAS 1220039-32-6

Imidazo[1,2-a]pyridine-2-carboxylic acid, 7-methyl-, hydrochloride (1:1)

Description:

Imidazo[1,2-a]pyridine-2-carboxylic acid, 7-methyl-, hydrochloride (1:1) is a chemical compound characterized by its imidazo-pyridine structure, which features a fused imidazole and pyridine ring system. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of nitrogen atoms in its ring structure. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents, while the hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its stability and solubility in aqueous solutions. This compound may be of interest in medicinal chemistry, particularly for its potential pharmacological properties. Its molecular interactions can be influenced by the methyl group at the 7-position, which may affect its biological activity and binding affinity to various targets. As with many heterocycles, it may also participate in various chemical reactions, making it a versatile compound in synthetic organic chemistry.

Formula: C₉H₈N₂O₂·ClH

InChI: InChI=1S/C9H8N2O2.ClH/c1-6-2-3-11-5-7(9(12)13)10-8(11)4-6;/h2-5H,1H3,(H,12,13);1H

InChI key: InChIKey=XKXDCTYUDHWIAX-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CN2C(=N1)C=C(C)C=C2.Cl

Synonyms:

• Imidazo[1,2-a]pyridine-2-carboxylic acid, 7-methyl-, hydrochloride (1:1)