CAS 1220039-36-0
:1,1-Dimethylethyl 3-(aminomethyl)-4-thiomorpholinecarboxylate
Description:
1,1-Dimethylethyl 3-(aminomethyl)-4-thiomorpholinecarboxylate is a chemical compound characterized by its unique structural features, including a thiomorpholine ring and an aminomethyl group. This compound belongs to a class of molecules that may exhibit biological activity, potentially serving as intermediates in pharmaceutical synthesis or as active pharmaceutical ingredients. The presence of the dimethyl group contributes to its steric hindrance, which can influence its reactivity and interaction with biological targets. The thiomorpholine moiety introduces sulfur into the structure, which can enhance the compound's lipophilicity and may affect its solubility and permeability. Additionally, the carboxylate functional group can participate in various chemical reactions, including esterification and amidation. Overall, the characteristics of this compound suggest potential applications in medicinal chemistry, although specific biological activities and properties would require further investigation through experimental studies.
Formula:C10H20N2O2S
InChI:InChI=1S/C10H20N2O2S/c1-10(2,3)14-9(13)12-4-5-15-7-8(12)6-11/h8H,4-7,11H2,1-3H3
InChI key:InChIKey=DDVWZKBCRRKHPY-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C(CN)CSCC1
Synonyms:- 4-Thiomorpholinecarboxylic acid, 3-(aminomethyl)-, 1,1-dimethylethyl ester
- 3-Aminomethyl-thiomorpholine-4-carboxylic acid tert-butyl ester
- 1,1-Dimethylethyl 3-(aminomethyl)-4-thiomorpholinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
tert-Butyl 3-(aminomethyl)thiomorpholine-4-carboxylate
CAS:Formula:C10H20N2O2SMolecular weight:232.3430
