CAS 1220039-37-1

3-Pyridinamine, 4-bromo-, hydrobromide (1:2)

Description:

3-Pyridinamine, 4-bromo-, hydrobromide (1:2) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 4-position of the pyridine ring indicates its role as a halogenated derivative, which can influence its reactivity and biological activity. The hydrobromide form suggests that the compound exists as a salt, where the amine group is protonated, enhancing its solubility in polar solvents. This compound may exhibit properties typical of both amines and halogenated organic compounds, such as potential applications in pharmaceuticals or agrochemicals. Its molecular interactions can be influenced by the bromine substituent, which may affect hydrogen bonding and steric hindrance. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Safety and handling precautions should be observed, as halogenated compounds can pose health risks and environmental concerns.

Formula: C₅H₅BrN₂·2BrH

InChI: InChI=1S/C5H5BrN2.2BrH/c6-4-1-2-8-3-5(4)7;;/h1-3H,7H2;2*1H

InChI key: InChIKey=BXWGSZFBRXTPKY-UHFFFAOYSA-N

SMILES: BrC=1C(N)=CN=CC1.Br

Synonyms:

• 3-Pyridinamine, 4-bromo-, hydrobromide (1:2)