CymitQuimica logo

CAS 1220039-44-0

:

4H-Pyrrolo[3,4-d]thiazole, 5,6-dihydro-2-phenyl-, hydrobromide (1:1)

Description:
4H-Pyrrolo[3,4-d]thiazole, 5,6-dihydro-2-phenyl-, hydrobromide (1:1) is a chemical compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and a thiazole ring. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of nitrogen and sulfur atoms in its structure. The hydrobromide salt form indicates that it is a protonated version of the base compound, which can enhance its solubility in polar solvents, making it suitable for various applications in medicinal chemistry and drug development. The presence of the phenyl group suggests potential for interactions with biological targets, possibly influencing its pharmacological properties. Additionally, the compound may exhibit specific reactivity patterns typical of thiazole derivatives, such as nucleophilic substitution or electrophilic aromatic substitution. Overall, this compound's structural features and salt form contribute to its potential utility in research and development within the fields of organic and medicinal chemistry.
Formula:C11H10N2S·BrH
InChI:InChI=1S/C11H10N2S.BrH/c1-2-4-8(5-3-1)11-13-9-6-12-7-10(9)14-11;/h1-5,12H,6-7H2;1H
InChI key:InChIKey=VFZKJCKZEPYQFQ-UHFFFAOYSA-N
SMILES:C1(=NC2=C(S1)CNC2)C3=CC=CC=C3.Br
Synonyms:
  • 4H-Pyrrolo[3,4-d]thiazole, 5,6-dihydro-2-phenyl-, hydrobromide (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.