CAS 1220039-45-1
:1-Bromo-3-[(cyclopropylmethyl)sulfonyl]benzene
Description:
1-Bromo-3-[(cyclopropylmethyl)sulfonyl]benzene is an organic compound characterized by the presence of a bromine atom and a sulfonyl group attached to a benzene ring. The sulfonyl group is linked to a cyclopropylmethyl substituent, which contributes to the compound's unique properties. This compound typically exhibits a moderate level of polarity due to the presence of the sulfonyl group, which can influence its solubility in various solvents. The bromine atom introduces reactivity, making it a potential candidate for further chemical transformations, such as nucleophilic substitutions. The cyclopropylmethyl group adds steric hindrance, which can affect the compound's reactivity and interaction with other molecules. In terms of applications, compounds like this may be explored in medicinal chemistry for their potential biological activities or as intermediates in synthetic pathways. Overall, the combination of functional groups in 1-Bromo-3-[(cyclopropylmethyl)sulfonyl]benzene provides a versatile platform for further chemical exploration and application.
Formula:C10H11BrO2S
InChI:InChI=1S/C10H11BrO2S/c11-9-2-1-3-10(6-9)14(12,13)7-8-4-5-8/h1-3,6,8H,4-5,7H2
InChI key:InChIKey=DPAMNYVYUWFJTO-UHFFFAOYSA-N
SMILES:S(CC1CC1)(=O)(=O)C2=CC(Br)=CC=C2
Synonyms:- 1-Bromo-3-cyclopropylmethanesulfonyl-benzene
- Benzene, 1-bromo-3-[(cyclopropylmethyl)sulfonyl]-
- 1-Bromo-3-[(cyclopropylmethyl)sulfonyl]benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.