CAS 1220039-54-2

2-(2-Aminophenyl)-4-oxazolecarboxylic acid

Description:

2-(2-Aminophenyl)-4-oxazolecarboxylic acid is a chemical compound characterized by its unique structure, which includes an oxazole ring and an amino group attached to a phenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The carboxylic acid moiety contributes to its acidity and can participate in various chemical reactions, including esterification and amidation. Additionally, the amino group may engage in hydrogen bonding, influencing the compound's solubility and interaction with biological systems. This substance may have applications in pharmaceuticals or as a building block in organic synthesis, owing to its functional versatility. Its specific properties, such as melting point, solubility, and reactivity, would depend on the conditions under which it is studied. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.

Formula: C₁₀H₈N₂O₃

InChI: InChI=1S/C10H8N2O3/c11-7-4-2-1-3-6(7)9-12-8(5-15-9)10(13)14/h1-5H,11H2,(H,13,14)

InChI key: InChIKey=SWHIWQKLISBAOP-UHFFFAOYSA-N

SMILES: NC1=C(C=CC=C1)C2=NC(C(O)=O)=CO2

Synonyms:

• 2-(2-Aminophenyl)-4-oxazolecarboxylic acid
• 4-Oxazolecarboxylic acid, 2-(2-aminophenyl)-