CymitQuimica logo

CAS 1220039-58-6

:

1-[2-(3-Bromophenyl)ethyl]piperazine

Description:
1-[2-(3-Bromophenyl)ethyl]piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 3-bromophenyl group attached to a two-carbon ethyl chain, contributing to its unique properties. The presence of the bromine atom enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The piperazine moiety is known for its ability to interact with various biological targets, including receptors and enzymes, which may suggest potential pharmacological applications. Additionally, the compound's structure allows for various substitution patterns, which can be explored to optimize its activity and selectivity. Its solubility, stability, and reactivity can vary based on the specific conditions and solvents used. Overall, 1-[2-(3-Bromophenyl)ethyl]piperazine represents a versatile scaffold for further chemical modifications and investigations in drug development and related fields.
Formula:C12H17BrN2
InChI:InChI=1S/C12H17BrN2/c13-12-3-1-2-11(10-12)4-7-15-8-5-14-6-9-15/h1-3,10,14H,4-9H2
InChI key:InChIKey=QOGNACVLONLVOC-UHFFFAOYSA-N
SMILES:C(CN1CCNCC1)C2=CC(Br)=CC=C2
Synonyms:
  • Piperazine, 1-[2-(3-bromophenyl)ethyl]-
  • 1-[2-(3-Bromophenyl)ethyl]piperazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.